C26H28FN7O — CID 122474616
N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[7-(3-fluorophenyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]phenyl]prop-2-enamide (PubChem CID 122474616) has the molecular formula C26H28FN7O and a molecular weight of 473.56 g/mol. Its IUPAC name is N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[7-(3-fluorophenyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[7-(3-fluorophenyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122474616 |
| Molecular Formula | C26H28FN7O |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[7-(3-fluorophenyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc3ccn(-c4cccc(F)c4)c3n2)ccc1N(C)CCN(C)C |
| InChI | InChI=1S/C26H28FN7O/c1-5-24(35)30-22-16-20(9-10-23(22)33(4)14-13-32(2)3)29-26-28-17-18-11-12-34(25(18)31-26)21-8-6-7-19(27)15-21/h5-12,15-17H,1,13-14H2,2-4H3,(H,30,35)(H,28,29,31) |
| InChIKey | DPDFQHXRSYRNNR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 78.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|