C29H38N6O — CID 145141661
N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[8-[(3E)-penta-1,3-dien-3-yl]quinazolin-2-yl]amino]phenyl]prop-2-enamide;ethane (PubChem CID 145141661) has the molecular formula C29H38N6O and a molecular weight of 486.66 g/mol. Its IUPAC name is N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[8-[(3E)-penta-1,3-dien-3-yl]quinazolin-2-yl]amino]phenyl]prop-2-enamide;ethane.
| Compound Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[8-[(3E)-penta-1,3-dien-3-yl]quinazolin-2-yl]amino]phenyl]prop-2-enamide;ethane |
|---|---|
| PubChem CID | 145141661 |
| Molecular Formula | C29H38N6O |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.31 |
| IUPAC Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[8-[(3E)-penta-1,3-dien-3-yl]quinazolin-2-yl]amino]phenyl]prop-2-enamide;ethane |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc3cccc(/C(C=C)=C/C)c3n2)ccc1N(C)CCN(C)C.CC |
| InChI | InChI=1S/C27H32N6O.C2H6/c1-7-19(8-2)22-12-10-11-20-18-28-27(31-26(20)22)29-21-13-14-24(33(6)16-15-32(4)5)23(17-21)30-25(34)9-3;1-2/h7-14,17-18H,1,3,15-16H2,2,4-6H3,(H,30,34)(H,28,29,31);1-2H3/b19-8+; |
| InChIKey | XRBADNQXSRNDIY-BTSUEJIHSA-N |
| XLogP | 6.11 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|