C29H29ClN6O — CID 122474420
N-[5-[[8-(3-chlorophenyl)quinazolin-2-yl]amino]-2-[methyl-(1-methylpyrrolidin-3-yl)amino]phenyl]prop-2-enamide (PubChem CID 122474420) has the molecular formula C29H29ClN6O and a molecular weight of 513.05 g/mol. Its IUPAC name is N-[5-[[8-(3-chlorophenyl)quinazolin-2-yl]amino]-2-[methyl-(1-methylpyrrolidin-3-yl)amino]phenyl]prop-2-enamide.
| Compound Name | N-[5-[[8-(3-chlorophenyl)quinazolin-2-yl]amino]-2-[methyl-(1-methylpyrrolidin-3-yl)amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122474420 |
| Molecular Formula | C29H29ClN6O |
| Molecular Weight | 513.05 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | N-[5-[[8-(3-chlorophenyl)quinazolin-2-yl]amino]-2-[methyl-(1-methylpyrrolidin-3-yl)amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc3cccc(-c4cccc(Cl)c4)c3n2)ccc1N(C)C1CCN(C)C1 |
| InChI | InChI=1S/C29H29ClN6O/c1-4-27(37)33-25-16-22(11-12-26(25)36(3)23-13-14-35(2)18-23)32-29-31-17-20-8-6-10-24(28(20)34-29)19-7-5-9-21(30)15-19/h4-12,15-17,23H,1,13-14,18H2,2-3H3,(H,33,37)(H,31,32,34) |
| InChIKey | APWNZHNPVWADRK-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.05 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|