C24H30N6O — CID 145141654
2-N-buta-1,3-dien-2-yl-1-N-[2-(dimethylamino)ethyl]-4-N-(8-methoxyquinazolin-2-yl)-1-N-methylbenzene-1,2,4-triamine (PubChem CID 145141654) has the molecular formula C24H30N6O and a molecular weight of 418.55 g/mol. Its IUPAC name is 2-N-buta-1,3-dien-2-yl-1-N-[2-(dimethylamino)ethyl]-4-N-(8-methoxyquinazolin-2-yl)-1-N-methylbenzene-1,2,4-triamine.
| Compound Name | 2-N-buta-1,3-dien-2-yl-1-N-[2-(dimethylamino)ethyl]-4-N-(8-methoxyquinazolin-2-yl)-1-N-methylbenzene-1,2,4-triamine |
|---|---|
| PubChem CID | 145141654 |
| Molecular Formula | C24H30N6O |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | 2-N-buta-1,3-dien-2-yl-1-N-[2-(dimethylamino)ethyl]-4-N-(8-methoxyquinazolin-2-yl)-1-N-methylbenzene-1,2,4-triamine |
| SMILES | C=CC(=C)Nc1cc(Nc2ncc3cccc(OC)c3n2)ccc1N(C)CCN(C)C |
| InChI | InChI=1S/C24H30N6O/c1-7-17(2)26-20-15-19(11-12-21(20)30(5)14-13-29(3)4)27-24-25-16-18-9-8-10-22(31-6)23(18)28-24/h7-12,15-16,26H,1-2,13-14H2,3-6H3,(H,25,27,28) |
| InChIKey | HZIMDUMEFDSEAH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|