C26H31N7O4 — CID 155229912
N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methoxy-5-[[4-[(3-nitrophenyl)methyl]pyrimidin-2-yl]amino]phenyl]prop-2-enamide (PubChem CID 155229912) has the molecular formula C26H31N7O4 and a molecular weight of 505.58 g/mol. Its IUPAC name is N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methoxy-5-[[4-[(3-nitrophenyl)methyl]pyrimidin-2-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methoxy-5-[[4-[(3-nitrophenyl)methyl]pyrimidin-2-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 155229912 |
| Molecular Formula | C26H31N7O4 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methoxy-5-[[4-[(3-nitrophenyl)methyl]pyrimidin-2-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2nccc(Cc3cccc([N+](=O)[O-])c3)n2)c(OC)cc1N(C)CCN(C)C |
| InChI | InChI=1S/C26H31N7O4/c1-6-25(34)29-21-16-22(24(37-5)17-23(21)32(4)13-12-31(2)3)30-26-27-11-10-19(28-26)14-18-8-7-9-20(15-18)33(35)36/h6-11,15-17H,1,12-14H2,2-5H3,(H,29,34)(H,27,28,30) |
| InChIKey | LJIDONNKHMBDPH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 125.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|