C9H5ClN4O2 — CID 50998940
2-chloro-4-(3-nitrophenyl)-1,3,5-triazine (PubChem CID 50998940) has the molecular formula C9H5ClN4O2 and a molecular weight of 236.62 g/mol. Its IUPAC name is 2-chloro-4-(3-nitrophenyl)-1,3,5-triazine.
| Compound Name | 2-chloro-4-(3-nitrophenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 50998940 |
| Molecular Formula | C9H5ClN4O2 |
| Molecular Weight | 236.62 g/mol |
| Exact Mass | 236.01 |
| IUPAC Name | 2-chloro-4-(3-nitrophenyl)-1,3,5-triazine |
| SMILES | O=[N+]([O-])c1cccc(-c2ncnc(Cl)n2)c1 |
| InChI | InChI=1S/C9H5ClN4O2/c10-9-12-5-11-8(13-9)6-2-1-3-7(4-6)14(15)16/h1-5H |
| InChIKey | XKTNKDXCEGXHEA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 81.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.62 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|