C8H5N3O3 — CID 2774286
3-(3-nitrophenyl)-1,2,4-oxadiazole (PubChem CID 2774286) has the molecular formula C8H5N3O3 and a molecular weight of 191.15 g/mol. Its IUPAC name is 3-(3-nitrophenyl)-1,2,4-oxadiazole.
| Compound Name | 3-(3-nitrophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 2774286 |
| Molecular Formula | C8H5N3O3 |
| Molecular Weight | 191.15 g/mol |
| Exact Mass | 191.03 |
| IUPAC Name | 3-(3-nitrophenyl)-1,2,4-oxadiazole |
| SMILES | O=[N+]([O-])c1cccc(-c2ncon2)c1 |
| InChI | InChI=1S/C8H5N3O3/c12-11(13)7-3-1-2-6(4-7)8-9-5-14-10-8/h1-5H |
| InChIKey | BXMPGUQFWQUYRY-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 82.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.15 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|