C13H10ClN5O2 — CID 132588090
6-chloro-2,8-dimethyl-7-(3-nitrophenyl)purine (PubChem CID 132588090) has the molecular formula C13H10ClN5O2 and a molecular weight of 303.71 g/mol. Its IUPAC name is 6-chloro-2,8-dimethyl-7-(3-nitrophenyl)purine.
| Compound Name | 6-chloro-2,8-dimethyl-7-(3-nitrophenyl)purine |
|---|---|
| PubChem CID | 132588090 |
| Molecular Formula | C13H10ClN5O2 |
| Molecular Weight | 303.71 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 6-chloro-2,8-dimethyl-7-(3-nitrophenyl)purine |
| SMILES | Cc1nc(Cl)c2c(n1)nc(C)n2-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H10ClN5O2/c1-7-15-12(14)11-13(16-7)17-8(2)18(11)9-4-3-5-10(6-9)19(20)21/h3-6H,1-2H3 |
| InChIKey | UCHZUJCLZBBHBQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.71 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|