C10H6N4O6 — CID 12988764
5-nitro-1-(3-nitrophenyl)pyrimidine-2,4-dione (PubChem CID 12988764) has the molecular formula C10H6N4O6 and a molecular weight of 278.18 g/mol. Its IUPAC name is 5-nitro-1-(3-nitrophenyl)pyrimidine-2,4-dione.
| Compound Name | 5-nitro-1-(3-nitrophenyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 12988764 |
| Molecular Formula | C10H6N4O6 |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 5-nitro-1-(3-nitrophenyl)pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(-c2cccc([N+](=O)[O-])c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H6N4O6/c15-9-8(14(19)20)5-12(10(16)11-9)6-2-1-3-7(4-6)13(17)18/h1-5H,(H,11,15,16) |
| InChIKey | ASUSSOUSSAQAAP-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 141.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|