C10H12N4O3 — CID 134100301
5,5-dimethyl-2-(3-nitrophenyl)-1,2,4-triazolidin-3-one (PubChem CID 134100301) has the molecular formula C10H12N4O3 and a molecular weight of 236.23 g/mol. Its IUPAC name is 5,5-dimethyl-2-(3-nitrophenyl)-1,2,4-triazolidin-3-one.
| Compound Name | 5,5-dimethyl-2-(3-nitrophenyl)-1,2,4-triazolidin-3-one |
|---|---|
| PubChem CID | 134100301 |
| Molecular Formula | C10H12N4O3 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 5,5-dimethyl-2-(3-nitrophenyl)-1,2,4-triazolidin-3-one |
| SMILES | CC1(C)NC(=O)N(c2cccc([N+](=O)[O-])c2)N1 |
| InChI | InChI=1S/C10H12N4O3/c1-10(2)11-9(15)13(12-10)7-4-3-5-8(6-7)14(16)17/h3-6,12H,1-2H3,(H,11,15) |
| InChIKey | JUJSEBZSVUTFCQ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|