C11H8FN3O5 — CID 115947678
1-(2-fluoro-4-nitrophenyl)-6-hydroxy-5-methylpyrimidine-2,4-dione (PubChem CID 115947678) has the molecular formula C11H8FN3O5 and a molecular weight of 281.20 g/mol. Its IUPAC name is 1-(2-fluoro-4-nitrophenyl)-6-hydroxy-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-(2-fluoro-4-nitrophenyl)-6-hydroxy-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 115947678 |
| Molecular Formula | C11H8FN3O5 |
| Molecular Weight | 281.20 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 1-(2-fluoro-4-nitrophenyl)-6-hydroxy-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1c(O)n(-c2ccc([N+](=O)[O-])cc2F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H8FN3O5/c1-5-9(16)13-11(18)14(10(5)17)8-3-2-6(15(19)20)4-7(8)12/h2-4,17H,1H3,(H,13,16,18) |
| InChIKey | RWWYEMADFILSAG-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.20 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|