C11H7F3N2O3 — CID 112600489
6-hydroxy-5-methyl-1-(2,3,5-trifluorophenyl)pyrimidine-2,4-dione (PubChem CID 112600489) has the molecular formula C11H7F3N2O3 and a molecular weight of 272.18 g/mol. Its IUPAC name is 6-hydroxy-5-methyl-1-(2,3,5-trifluorophenyl)pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-methyl-1-(2,3,5-trifluorophenyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 112600489 |
| Molecular Formula | C11H7F3N2O3 |
| Molecular Weight | 272.18 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 6-hydroxy-5-methyl-1-(2,3,5-trifluorophenyl)pyrimidine-2,4-dione |
| SMILES | Cc1c(O)n(-c2cc(F)cc(F)c2F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H7F3N2O3/c1-4-9(17)15-11(19)16(10(4)18)7-3-5(12)2-6(13)8(7)14/h2-3,18H,1H3,(H,15,17,19) |
| InChIKey | FAPHGHPJHYBLDJ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.18 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|