C12H11IN2O3 — CID 114258109
6-hydroxy-1-(3-iodo-2-methylphenyl)-5-methylpyrimidine-2,4-dione (PubChem CID 114258109) has the molecular formula C12H11IN2O3 and a molecular weight of 358.14 g/mol. Its IUPAC name is 6-hydroxy-1-(3-iodo-2-methylphenyl)-5-methylpyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-1-(3-iodo-2-methylphenyl)-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 114258109 |
| Molecular Formula | C12H11IN2O3 |
| Molecular Weight | 358.14 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | 6-hydroxy-1-(3-iodo-2-methylphenyl)-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1c(I)cccc1-n1c(O)c(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H11IN2O3/c1-6-8(13)4-3-5-9(6)15-11(17)7(2)10(16)14-12(15)18/h3-5,17H,1-2H3,(H,14,16,18) |
| InChIKey | FOEYYRJRFNUSPP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.14 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|