C16H10F3N3O4 — CID 12812383
1-(3-nitrophenyl)-3-(2,2,2-trifluoroethyl)quinazoline-2,4-dione (PubChem CID 12812383) has the molecular formula C16H10F3N3O4 and a molecular weight of 365.27 g/mol. Its IUPAC name is 1-(3-nitrophenyl)-3-(2,2,2-trifluoroethyl)quinazoline-2,4-dione.
| Compound Name | 1-(3-nitrophenyl)-3-(2,2,2-trifluoroethyl)quinazoline-2,4-dione |
|---|---|
| PubChem CID | 12812383 |
| Molecular Formula | C16H10F3N3O4 |
| Molecular Weight | 365.27 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 1-(3-nitrophenyl)-3-(2,2,2-trifluoroethyl)quinazoline-2,4-dione |
| SMILES | O=c1c2ccccc2n(-c2cccc([N+](=O)[O-])c2)c(=O)n1CC(F)(F)F |
| InChI | InChI=1S/C16H10F3N3O4/c17-16(18,19)9-20-14(23)12-6-1-2-7-13(12)21(15(20)24)10-4-3-5-11(8-10)22(25)26/h1-8H,9H2 |
| InChIKey | LPMCTGUZSYUQLX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 87.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|