C28H21N5O2 — CID 54366064
N-[3-[3-oxo-2-(pyridin-3-ylmethyl)pyrido[2,3-b]pyrazin-4-yl]phenyl]-3-phenylprop-2-enamide (PubChem CID 54366064) has the molecular formula C28H21N5O2 and a molecular weight of 459.51 g/mol. Its IUPAC name is N-[3-[3-oxo-2-(pyridin-3-ylmethyl)pyrido[2,3-b]pyrazin-4-yl]phenyl]-3-phenylprop-2-enamide.
| Compound Name | N-[3-[3-oxo-2-(pyridin-3-ylmethyl)pyrido[2,3-b]pyrazin-4-yl]phenyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 54366064 |
| Molecular Formula | C28H21N5O2 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | N-[3-[3-oxo-2-(pyridin-3-ylmethyl)pyrido[2,3-b]pyrazin-4-yl]phenyl]-3-phenylprop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1)Nc1cccc(-n2c(=O)c(Cc3cccnc3)nc3cccnc32)c1 |
| InChI | InChI=1S/C28H21N5O2/c34-26(14-13-20-7-2-1-3-8-20)31-22-10-4-11-23(18-22)33-27-24(12-6-16-30-27)32-25(28(33)35)17-21-9-5-15-29-19-21/h1-16,18-19H,17H2,(H,31,34) |
| InChIKey | UPWGDICIZNRHFG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|