C21H21N5O — CID 139932415
3-(3-aminophenyl)-1-[[4-(dimethylamino)phenyl]methyl]imidazo[4,5-b]pyridin-2-one (PubChem CID 139932415) has the molecular formula C21H21N5O and a molecular weight of 359.43 g/mol. Its IUPAC name is 3-(3-aminophenyl)-1-[[4-(dimethylamino)phenyl]methyl]imidazo[4,5-b]pyridin-2-one.
| Compound Name | 3-(3-aminophenyl)-1-[[4-(dimethylamino)phenyl]methyl]imidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 139932415 |
| Molecular Formula | C21H21N5O |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 3-(3-aminophenyl)-1-[[4-(dimethylamino)phenyl]methyl]imidazo[4,5-b]pyridin-2-one |
| SMILES | CN(C)c1ccc(Cn2c(=O)n(-c3cccc(N)c3)c3ncccc32)cc1 |
| InChI | InChI=1S/C21H21N5O/c1-24(2)17-10-8-15(9-11-17)14-25-19-7-4-12-23-20(19)26(21(25)27)18-6-3-5-16(22)13-18/h3-13H,14,22H2,1-2H3 |
| InChIKey | PUSQWUJZRXCGOF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 69.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|