C20H11F6N3O — CID 11362239
1,3-bis[3-(trifluoromethyl)phenyl]imidazo[4,5-b]pyridin-2-one (PubChem CID 11362239) has the molecular formula C20H11F6N3O and a molecular weight of 423.32 g/mol. Its IUPAC name is 1,3-bis[3-(trifluoromethyl)phenyl]imidazo[4,5-b]pyridin-2-one.
| Compound Name | 1,3-bis[3-(trifluoromethyl)phenyl]imidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 11362239 |
| Molecular Formula | C20H11F6N3O |
| Molecular Weight | 423.32 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | 1,3-bis[3-(trifluoromethyl)phenyl]imidazo[4,5-b]pyridin-2-one |
| SMILES | O=c1n(-c2cccc(C(F)(F)F)c2)c2cccnc2n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H11F6N3O/c21-19(22,23)12-4-1-6-14(10-12)28-16-8-3-9-27-17(16)29(18(28)30)15-7-2-5-13(11-15)20(24,25)26/h1-11H |
| InChIKey | ICVZTLOOJNCUPZ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.32 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |