C14H9F3N2 — CID 151593977
1-[3-(trifluoromethyl)phenyl]pyrrolo[2,3-b]pyridine (PubChem CID 151593977) has the molecular formula C14H9F3N2 and a molecular weight of 262.23 g/mol. Its IUPAC name is 1-[3-(trifluoromethyl)phenyl]pyrrolo[2,3-b]pyridine.
| Compound Name | 1-[3-(trifluoromethyl)phenyl]pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 151593977 |
| Molecular Formula | C14H9F3N2 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 1-[3-(trifluoromethyl)phenyl]pyrrolo[2,3-b]pyridine |
| SMILES | FC(F)(F)c1cccc(-n2ccc3cccnc32)c1 |
| InChI | InChI=1S/C14H9F3N2/c15-14(16,17)11-4-1-5-12(9-11)19-8-6-10-3-2-7-18-13(10)19/h1-9H |
| InChIKey | QJBUFESCQSBAHO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |