C20H15F3N4O — CID 141271369
[4-[1-[3-(trifluoromethyl)phenyl]indol-5-yl]oxypyrimidin-2-yl]methanamine (PubChem CID 141271369) has the molecular formula C20H15F3N4O and a molecular weight of 384.36 g/mol. Its IUPAC name is [4-[1-[3-(trifluoromethyl)phenyl]indol-5-yl]oxypyrimidin-2-yl]methanamine.
| Compound Name | [4-[1-[3-(trifluoromethyl)phenyl]indol-5-yl]oxypyrimidin-2-yl]methanamine |
|---|---|
| PubChem CID | 141271369 |
| Molecular Formula | C20H15F3N4O |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | [4-[1-[3-(trifluoromethyl)phenyl]indol-5-yl]oxypyrimidin-2-yl]methanamine |
| SMILES | NCc1nccc(Oc2ccc3c(ccn3-c3cccc(C(F)(F)F)c3)c2)n1 |
| InChI | InChI=1S/C20H15F3N4O/c21-20(22,23)14-2-1-3-15(11-14)27-9-7-13-10-16(4-5-17(13)27)28-19-6-8-25-18(12-24)26-19/h1-11H,12,24H2 |
| InChIKey | XZOJOSOWCXJJDU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |