C25H23F3N4O2 — CID 90983084
2-[[4-[1-[C-methyl-N-[3-(trifluoromethyl)phenyl]carbonimidoyl]indol-5-yl]oxy-2-pyridinyl]methylamino]ethanol (PubChem CID 90983084) has the molecular formula C25H23F3N4O2 and a molecular weight of 468.48 g/mol. Its IUPAC name is 2-[[4-[1-[C-methyl-N-[3-(trifluoromethyl)phenyl]carbonimidoyl]indol-5-yl]oxy-2-pyridinyl]methylamino]ethanol.
| Compound Name | 2-[[4-[1-[C-methyl-N-[3-(trifluoromethyl)phenyl]carbonimidoyl]indol-5-yl]oxy-2-pyridinyl]methylamino]ethanol |
|---|---|
| PubChem CID | 90983084 |
| Molecular Formula | C25H23F3N4O2 |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 2-[[4-[1-[C-methyl-N-[3-(trifluoromethyl)phenyl]carbonimidoyl]indol-5-yl]oxy-2-pyridinyl]methylamino]ethanol |
| SMILES | C/C(=N\c1cccc(C(F)(F)F)c1)n1ccc2cc(Oc3ccnc(CNCCO)c3)ccc21 |
| InChI | InChI=1S/C25H23F3N4O2/c1-17(31-20-4-2-3-19(14-20)25(26,27)28)32-11-8-18-13-22(5-6-24(18)32)34-23-7-9-30-21(15-23)16-29-10-12-33/h2-9,11,13-15,29,33H,10,12,16H2,1H3/b31-17+ |
| InChIKey | NPCJKQOYBMPFTA-KBVAKVRCSA-N |
| XLogP | 5.53 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|