C24H22F3N5O4S — CID 59394221
5-[6-[(2-methylsulfonylethylamino)methyl]pyrimidin-4-yl]oxy-N-[3-(trifluoromethyl)phenyl]indole-1-carboxamide (PubChem CID 59394221) has the molecular formula C24H22F3N5O4S and a molecular weight of 533.53 g/mol. Its IUPAC name is 5-[6-[(2-methylsulfonylethylamino)methyl]pyrimidin-4-yl]oxy-N-[3-(trifluoromethyl)phenyl]indole-1-carboxamide.
| Compound Name | 5-[6-[(2-methylsulfonylethylamino)methyl]pyrimidin-4-yl]oxy-N-[3-(trifluoromethyl)phenyl]indole-1-carboxamide |
|---|---|
| PubChem CID | 59394221 |
| Molecular Formula | C24H22F3N5O4S |
| Molecular Weight | 533.53 g/mol |
| Exact Mass | 533.13 |
| IUPAC Name | 5-[6-[(2-methylsulfonylethylamino)methyl]pyrimidin-4-yl]oxy-N-[3-(trifluoromethyl)phenyl]indole-1-carboxamide |
| SMILES | CS(=O)(=O)CCNCc1cc(Oc2ccc3c(ccn3C(=O)Nc3cccc(C(F)(F)F)c3)c2)ncn1 |
| InChI | InChI=1S/C24H22F3N5O4S/c1-37(34,35)10-8-28-14-19-13-22(30-15-29-19)36-20-5-6-21-16(11-20)7-9-32(21)23(33)31-18-4-2-3-17(12-18)24(25,26)27/h2-7,9,11-13,15,28H,8,10,14H2,1H3,(H,31,33) |
| InChIKey | ACKYYFPQAMANRX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.53 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|