C24H21F3N4O3 — CID 59394192
5-[[2-[(2-hydroxyethylamino)methyl]-4-pyridinyl]oxy]-N-[3-(trifluoromethyl)phenyl]indole-1-carboxamide (PubChem CID 59394192) has the molecular formula C24H21F3N4O3 and a molecular weight of 470.45 g/mol. Its IUPAC name is 5-[[2-[(2-hydroxyethylamino)methyl]-4-pyridinyl]oxy]-N-[3-(trifluoromethyl)phenyl]indole-1-carboxamide.
| Compound Name | 5-[[2-[(2-hydroxyethylamino)methyl]-4-pyridinyl]oxy]-N-[3-(trifluoromethyl)phenyl]indole-1-carboxamide |
|---|---|
| PubChem CID | 59394192 |
| Molecular Formula | C24H21F3N4O3 |
| Molecular Weight | 470.45 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | 5-[[2-[(2-hydroxyethylamino)methyl]-4-pyridinyl]oxy]-N-[3-(trifluoromethyl)phenyl]indole-1-carboxamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)n1ccc2cc(Oc3ccnc(CNCCO)c3)ccc21 |
| InChI | InChI=1S/C24H21F3N4O3/c25-24(26,27)17-2-1-3-18(13-17)30-23(33)31-10-7-16-12-20(4-5-22(16)31)34-21-6-8-29-19(14-21)15-28-9-11-32/h1-8,10,12-14,28,32H,9,11,15H2,(H,30,33) |
| InChIKey | JFGLECBQHYUTCX-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.45 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|