C23H18F3N3O5S — CID 142709591
1-[4-[1-[[3-(trifluoromethyl)phenyl]carbamoyl]indol-5-yl]oxy-2-pyridinyl]ethanesulfonic acid (PubChem CID 142709591) has the molecular formula C23H18F3N3O5S and a molecular weight of 505.47 g/mol. Its IUPAC name is 1-[4-[1-[[3-(trifluoromethyl)phenyl]carbamoyl]indol-5-yl]oxy-2-pyridinyl]ethanesulfonic acid.
| Compound Name | 1-[4-[1-[[3-(trifluoromethyl)phenyl]carbamoyl]indol-5-yl]oxy-2-pyridinyl]ethanesulfonic acid |
|---|---|
| PubChem CID | 142709591 |
| Molecular Formula | C23H18F3N3O5S |
| Molecular Weight | 505.47 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | 1-[4-[1-[[3-(trifluoromethyl)phenyl]carbamoyl]indol-5-yl]oxy-2-pyridinyl]ethanesulfonic acid |
| SMILES | CC(c1cc(Oc2ccc3c(ccn3C(=O)Nc3cccc(C(F)(F)F)c3)c2)ccn1)S(=O)(=O)O |
| InChI | InChI=1S/C23H18F3N3O5S/c1-14(35(31,32)33)20-13-19(7-9-27-20)34-18-5-6-21-15(11-18)8-10-29(21)22(30)28-17-4-2-3-16(12-17)23(24,25)26/h2-14H,1H3,(H,28,30)(H,31,32,33) |
| InChIKey | FXNDAFVLRUXABF-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.47 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|