C28H27F3N6O3 — CID 59394317
5-[6-[[2-(2-oxopiperidin-1-yl)ethylamino]methyl]pyrimidin-4-yl]oxy-N-[3-(trifluoromethyl)phenyl]indole-1-carboxamide (PubChem CID 59394317) has the molecular formula C28H27F3N6O3 and a molecular weight of 552.56 g/mol. Its IUPAC name is 5-[6-[[2-(2-oxopiperidin-1-yl)ethylamino]methyl]pyrimidin-4-yl]oxy-N-[3-(trifluoromethyl)phenyl]indole-1-carboxamide.
| Compound Name | 5-[6-[[2-(2-oxopiperidin-1-yl)ethylamino]methyl]pyrimidin-4-yl]oxy-N-[3-(trifluoromethyl)phenyl]indole-1-carboxamide |
|---|---|
| PubChem CID | 59394317 |
| Molecular Formula | C28H27F3N6O3 |
| Molecular Weight | 552.56 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | 5-[6-[[2-(2-oxopiperidin-1-yl)ethylamino]methyl]pyrimidin-4-yl]oxy-N-[3-(trifluoromethyl)phenyl]indole-1-carboxamide |
| SMILES | O=C1CCCCN1CCNCc1cc(Oc2ccc3c(ccn3C(=O)Nc3cccc(C(F)(F)F)c3)c2)ncn1 |
| InChI | InChI=1S/C28H27F3N6O3/c29-28(30,31)20-4-3-5-21(15-20)35-27(39)37-12-9-19-14-23(7-8-24(19)37)40-25-16-22(33-18-34-25)17-32-10-13-36-11-2-1-6-26(36)38/h3-5,7-9,12,14-16,18,32H,1-2,6,10-11,13,17H2,(H,35,39) |
| InChIKey | VCCKIVRTMFHUSQ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.56 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|