C12H8F3N3OS — CID 2743303
3-prop-2-ynylsulfanyl-4-[3-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-5-one (PubChem CID 2743303) has the molecular formula C12H8F3N3OS and a molecular weight of 299.28 g/mol. Its IUPAC name is 3-prop-2-ynylsulfanyl-4-[3-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-5-one.
| Compound Name | 3-prop-2-ynylsulfanyl-4-[3-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 2743303 |
| Molecular Formula | C12H8F3N3OS |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 3-prop-2-ynylsulfanyl-4-[3-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-5-one |
| SMILES | C#CCSc1n[nH]c(=O)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H8F3N3OS/c1-2-6-20-11-17-16-10(19)18(11)9-5-3-4-8(7-9)12(13,14)15/h1,3-5,7H,6H2,(H,16,19) |
| InChIKey | FMEMQXHYERKXEB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|