C21H18F3N3O2S — CID 2732223
3-[(3,4-dimethoxyphenyl)methyl]-5-prop-2-ynylsulfanyl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazole (PubChem CID 2732223) has the molecular formula C21H18F3N3O2S and a molecular weight of 433.46 g/mol. Its IUPAC name is 3-[(3,4-dimethoxyphenyl)methyl]-5-prop-2-ynylsulfanyl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazole.
| Compound Name | 3-[(3,4-dimethoxyphenyl)methyl]-5-prop-2-ynylsulfanyl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 2732223 |
| Molecular Formula | C21H18F3N3O2S |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 3-[(3,4-dimethoxyphenyl)methyl]-5-prop-2-ynylsulfanyl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazole |
| SMILES | C#CCSc1nnc(Cc2ccc(OC)c(OC)c2)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H18F3N3O2S/c1-4-10-30-20-26-25-19(12-14-8-9-17(28-2)18(11-14)29-3)27(20)16-7-5-6-15(13-16)21(22,23)24/h1,5-9,11,13H,10,12H2,2-3H3 |
| InChIKey | SWKJFGJIEWEQPY-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|