C24H27F3N4OS — CID 4541995
5-[[5-benzyl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanyl]-N-propan-2-ylpentanamide (PubChem CID 4541995) has the molecular formula C24H27F3N4OS and a molecular weight of 476.57 g/mol. Its IUPAC name is 5-[[5-benzyl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanyl]-N-propan-2-ylpentanamide.
| Compound Name | 5-[[5-benzyl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanyl]-N-propan-2-ylpentanamide |
|---|---|
| PubChem CID | 4541995 |
| Molecular Formula | C24H27F3N4OS |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | 5-[[5-benzyl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanyl]-N-propan-2-ylpentanamide |
| SMILES | CC(C)NC(=O)CCCCSc1nnc(Cc2ccccc2)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H27F3N4OS/c1-17(2)28-22(32)13-6-7-14-33-23-30-29-21(15-18-9-4-3-5-10-18)31(23)20-12-8-11-19(16-20)24(25,26)27/h3-5,8-12,16-17H,6-7,13-15H2,1-2H3,(H,28,32) |
| InChIKey | PHIJFOQUOSPERX-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|