C29H27Cl2F3N4OS — CID 3968296
5-[[5-benzyl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(2,4-dichlorophenyl)ethyl]pentanamide (PubChem CID 3968296) has the molecular formula C29H27Cl2F3N4OS and a molecular weight of 607.53 g/mol. Its IUPAC name is 5-[[5-benzyl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(2,4-dichlorophenyl)ethyl]pentanamide.
| Compound Name | 5-[[5-benzyl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(2,4-dichlorophenyl)ethyl]pentanamide |
|---|---|
| PubChem CID | 3968296 |
| Molecular Formula | C29H27Cl2F3N4OS |
| Molecular Weight | 607.53 g/mol |
| Exact Mass | 606.12 |
| IUPAC Name | 5-[[5-benzyl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(2,4-dichlorophenyl)ethyl]pentanamide |
| SMILES | O=C(CCCCSc1nnc(Cc2ccccc2)n1-c1cccc(C(F)(F)F)c1)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C29H27Cl2F3N4OS/c30-23-13-12-21(25(31)19-23)14-15-35-27(39)11-4-5-16-40-28-37-36-26(17-20-7-2-1-3-8-20)38(28)24-10-6-9-22(18-24)29(32,33)34/h1-3,6-10,12-13,18-19H,4-5,11,14-17H2,(H,35,39) |
| InChIKey | FVSBMZUHLSDJSQ-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.53 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|