C13H16ClF3N4OS — CID 154906282
3-[[5-(aminomethyl)-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanyl]propan-1-ol;hydrochloride (PubChem CID 154906282) has the molecular formula C13H16ClF3N4OS and a molecular weight of 368.81 g/mol. Its IUPAC name is 3-[[5-(aminomethyl)-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanyl]propan-1-ol;hydrochloride.
| Compound Name | 3-[[5-(aminomethyl)-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanyl]propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 154906282 |
| Molecular Formula | C13H16ClF3N4OS |
| Molecular Weight | 368.81 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 3-[[5-(aminomethyl)-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]sulfanyl]propan-1-ol;hydrochloride |
| SMILES | Cl.NCc1nnc(SCCCO)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H15F3N4OS.ClH/c14-13(15,16)9-3-1-4-10(7-9)20-11(8-17)18-19-12(20)22-6-2-5-21;/h1,3-4,7,21H,2,5-6,8,17H2;1H |
| InChIKey | IBVRSBCUDXCVDG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.81 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|