C12H12F3N3OS — CID 155775139
3-(3-hydroxypropyl)-4-[3-(trifluoromethyl)phenyl]-1H-1,2,4-triazole-5-thione (PubChem CID 155775139) has the molecular formula C12H12F3N3OS and a molecular weight of 303.31 g/mol. Its IUPAC name is 3-(3-hydroxypropyl)-4-[3-(trifluoromethyl)phenyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(3-hydroxypropyl)-4-[3-(trifluoromethyl)phenyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 155775139 |
| Molecular Formula | C12H12F3N3OS |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 3-(3-hydroxypropyl)-4-[3-(trifluoromethyl)phenyl]-1H-1,2,4-triazole-5-thione |
| SMILES | OCCCc1n[nH]c(=S)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H12F3N3OS/c13-12(14,15)8-3-1-4-9(7-8)18-10(5-2-6-19)16-17-11(18)20/h1,3-4,7,19H,2,5-6H2,(H,17,20) |
| InChIKey | GNEHQZIAQYZOJT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|