C17H10F6N2S3 — CID 169074232
4,5-bis(sulfanyl)-1,3-bis[3-(trifluoromethyl)phenyl]imidazole-2-thione (PubChem CID 169074232) has the molecular formula C17H10F6N2S3 and a molecular weight of 452.47 g/mol. Its IUPAC name is 4,5-bis(sulfanyl)-1,3-bis[3-(trifluoromethyl)phenyl]imidazole-2-thione.
| Compound Name | 4,5-bis(sulfanyl)-1,3-bis[3-(trifluoromethyl)phenyl]imidazole-2-thione |
|---|---|
| PubChem CID | 169074232 |
| Molecular Formula | C17H10F6N2S3 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 451.99 |
| IUPAC Name | 4,5-bis(sulfanyl)-1,3-bis[3-(trifluoromethyl)phenyl]imidazole-2-thione |
| SMILES | FC(F)(F)c1cccc(-n2c(S)c(S)n(-c3cccc(C(F)(F)F)c3)c2=S)c1 |
| InChI | InChI=1S/C17H10F6N2S3/c18-16(19,20)9-3-1-5-11(7-9)24-13(26)14(27)25(15(24)28)12-6-2-4-10(8-12)17(21,22)23/h1-8,26-27H |
| InChIKey | XSHJCCOJAMEEDG-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 9.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|