C23H28N2S3 — CID 140616806
1-(3-tert-butylphenyl)-3-[3-(2-methylpropyl)phenyl]-4,5-bis(sulfanyl)imidazole-2-thione (PubChem CID 140616806) has the molecular formula C23H28N2S3 and a molecular weight of 428.69 g/mol. Its IUPAC name is 1-(3-tert-butylphenyl)-3-[3-(2-methylpropyl)phenyl]-4,5-bis(sulfanyl)imidazole-2-thione.
| Compound Name | 1-(3-tert-butylphenyl)-3-[3-(2-methylpropyl)phenyl]-4,5-bis(sulfanyl)imidazole-2-thione |
|---|---|
| PubChem CID | 140616806 |
| Molecular Formula | C23H28N2S3 |
| Molecular Weight | 428.69 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 1-(3-tert-butylphenyl)-3-[3-(2-methylpropyl)phenyl]-4,5-bis(sulfanyl)imidazole-2-thione |
| SMILES | CC(C)Cc1cccc(-n2c(S)c(S)n(-c3cccc(C(C)(C)C)c3)c2=S)c1 |
| InChI | InChI=1S/C23H28N2S3/c1-15(2)12-16-8-6-10-18(13-16)24-20(26)21(27)25(22(24)28)19-11-7-9-17(14-19)23(3,4)5/h6-11,13-15,26-27H,12H2,1-5H3 |
| InChIKey | HDEXXBCPKIGVFX-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 9.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.69 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|