C17H13F3N2S3 — CID 158479987
1-(3-methylphenyl)-4,5-bis(sulfanyl)-3-[3-(trifluoromethyl)phenyl]imidazole-2-thione (PubChem CID 158479987) has the molecular formula C17H13F3N2S3 and a molecular weight of 398.50 g/mol. Its IUPAC name is 1-(3-methylphenyl)-4,5-bis(sulfanyl)-3-[3-(trifluoromethyl)phenyl]imidazole-2-thione.
| Compound Name | 1-(3-methylphenyl)-4,5-bis(sulfanyl)-3-[3-(trifluoromethyl)phenyl]imidazole-2-thione |
|---|---|
| PubChem CID | 158479987 |
| Molecular Formula | C17H13F3N2S3 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.02 |
| IUPAC Name | 1-(3-methylphenyl)-4,5-bis(sulfanyl)-3-[3-(trifluoromethyl)phenyl]imidazole-2-thione |
| SMILES | Cc1cccc(-n2c(S)c(S)n(-c3cccc(C(F)(F)F)c3)c2=S)c1 |
| InChI | InChI=1S/C17H13F3N2S3/c1-10-4-2-6-12(8-10)21-14(23)15(24)22(16(21)25)13-7-3-5-11(9-13)17(18,19)20/h2-9,23-24H,1H3 |
| InChIKey | MVFCUOYRBQQNMR-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 9.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|