C25H21F3N2OS2 — CID 126348444
(5E)-3-(2,4-dimethylphenyl)-5-[[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126348444) has the molecular formula C25H21F3N2OS2 and a molecular weight of 486.58 g/mol. Its IUPAC name is (5E)-3-(2,4-dimethylphenyl)-5-[[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(2,4-dimethylphenyl)-5-[[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126348444 |
| Molecular Formula | C25H21F3N2OS2 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | (5E)-3-(2,4-dimethylphenyl)-5-[[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(N2C(=O)/C(=C\c3cc(C)n(-c4cccc(C(F)(F)F)c4)c3C)SC2=S)c(C)c1 |
| InChI | InChI=1S/C25H21F3N2OS2/c1-14-8-9-21(15(2)10-14)30-23(31)22(33-24(30)32)12-18-11-16(3)29(17(18)4)20-7-5-6-19(13-20)25(26,27)28/h5-13H,1-4H3/b22-12+ |
| InChIKey | DMBUKAOKKYRNFK-WSDLNYQXSA-N |
| XLogP | 7.14 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|