C24H17ClF3N3O2S2 — CID 126352789
4-chloro-N-[(5Z)-5-[[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide (PubChem CID 126352789) has the molecular formula C24H17ClF3N3O2S2 and a molecular weight of 536.00 g/mol. Its IUPAC name is 4-chloro-N-[(5Z)-5-[[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | 4-chloro-N-[(5Z)-5-[[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 126352789 |
| Molecular Formula | C24H17ClF3N3O2S2 |
| Molecular Weight | 536.00 g/mol |
| Exact Mass | 535.04 |
| IUPAC Name | 4-chloro-N-[(5Z)-5-[[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
| SMILES | Cc1cc(/C=C2\SC(=S)N(NC(=O)c3ccc(Cl)cc3)C2=O)c(C)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H17ClF3N3O2S2/c1-13-10-16(14(2)30(13)19-5-3-4-17(12-19)24(26,27)28)11-20-22(33)31(23(34)35-20)29-21(32)15-6-8-18(25)9-7-15/h3-12H,1-2H3,(H,29,32)/b20-11- |
| InChIKey | OQEPNCACRXYLAH-JAIQZWGSSA-N |
| XLogP | 6.31 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.00 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|