C24H17F3N6OS2 — CID 57400885
(5Z)-5-[[2,5-dimethyl-1-[3-(2H-tetrazol-5-yl)phenyl]pyrrol-3-yl]methylidene]-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one (PubChem CID 57400885) has the molecular formula C24H17F3N6OS2 and a molecular weight of 526.57 g/mol. Its IUPAC name is (5Z)-5-[[2,5-dimethyl-1-[3-(2H-tetrazol-5-yl)phenyl]pyrrol-3-yl]methylidene]-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[2,5-dimethyl-1-[3-(2H-tetrazol-5-yl)phenyl]pyrrol-3-yl]methylidene]-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 57400885 |
| Molecular Formula | C24H17F3N6OS2 |
| Molecular Weight | 526.57 g/mol |
| Exact Mass | 526.09 |
| IUPAC Name | (5Z)-5-[[2,5-dimethyl-1-[3-(2H-tetrazol-5-yl)phenyl]pyrrol-3-yl]methylidene]-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(/C=C2\SC(=S)N(c3cccc(C(F)(F)F)c3)C2=O)c(C)n1-c1cccc(-c2nn[nH]n2)c1 |
| InChI | InChI=1S/C24H17F3N6OS2/c1-13-9-16(14(2)32(13)18-7-3-5-15(10-18)21-28-30-31-29-21)11-20-22(34)33(23(35)36-20)19-8-4-6-17(12-19)24(25,26)27/h3-12H,1-2H3,(H,28,29,30,31)/b20-11- |
| InChIKey | BGFOUGOFRJFRIR-JAIQZWGSSA-N |
| XLogP | 5.70 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.57 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|