C28H43Br — CID 163429812
1-bromo-4-tert-butyl-2-(2-methylpropyl)benzene;1-tert-butyl-3-(2-methylpropyl)benzene (PubChem CID 163429812) has the molecular formula C28H43Br and a molecular weight of 459.56 g/mol. Its IUPAC name is 1-bromo-4-tert-butyl-2-(2-methylpropyl)benzene;1-tert-butyl-3-(2-methylpropyl)benzene.
| Compound Name | 1-bromo-4-tert-butyl-2-(2-methylpropyl)benzene;1-tert-butyl-3-(2-methylpropyl)benzene |
|---|---|
| PubChem CID | 163429812 |
| Molecular Formula | C28H43Br |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | 1-bromo-4-tert-butyl-2-(2-methylpropyl)benzene;1-tert-butyl-3-(2-methylpropyl)benzene |
| SMILES | CC(C)Cc1cc(C(C)(C)C)ccc1Br.CC(C)Cc1cccc(C(C)(C)C)c1 |
| InChI | InChI=1S/C14H21Br.C14H22/c1-10(2)8-11-9-12(14(3,4)5)6-7-13(11)15;1-11(2)9-12-7-6-8-13(10-12)14(3,4)5/h6-7,9-10H,8H2,1-5H3;6-8,10-11H,9H2,1-5H3 |
| InChIKey | APNKQFIKJGRRMA-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |