C16H11F3N4O2S2 — CID 2807226
3-[(2-nitrophenyl)sulfanylmethyl]-4-[3-(trifluoromethyl)phenyl]-1H-1,2,4-triazole-5-thione (PubChem CID 2807226) has the molecular formula C16H11F3N4O2S2 and a molecular weight of 412.42 g/mol. Its IUPAC name is 3-[(2-nitrophenyl)sulfanylmethyl]-4-[3-(trifluoromethyl)phenyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[(2-nitrophenyl)sulfanylmethyl]-4-[3-(trifluoromethyl)phenyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 2807226 |
| Molecular Formula | C16H11F3N4O2S2 |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | 3-[(2-nitrophenyl)sulfanylmethyl]-4-[3-(trifluoromethyl)phenyl]-1H-1,2,4-triazole-5-thione |
| SMILES | O=[N+]([O-])c1ccccc1SCc1n[nH]c(=S)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H11F3N4O2S2/c17-16(18,19)10-4-3-5-11(8-10)22-14(20-21-15(22)26)9-27-13-7-2-1-6-12(13)23(24)25/h1-8H,9H2,(H,21,26) |
| InChIKey | WOIAVOUVKRGLSF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 76.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|