C26H20F3N5O4S — CID 15993656
4-methyl-3-nitro-N-[[5-phenacylsulfanyl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]methyl]benzamide (PubChem CID 15993656) has the molecular formula C26H20F3N5O4S and a molecular weight of 555.54 g/mol. Its IUPAC name is 4-methyl-3-nitro-N-[[5-phenacylsulfanyl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]methyl]benzamide.
| Compound Name | 4-methyl-3-nitro-N-[[5-phenacylsulfanyl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 15993656 |
| Molecular Formula | C26H20F3N5O4S |
| Molecular Weight | 555.54 g/mol |
| Exact Mass | 555.12 |
| IUPAC Name | 4-methyl-3-nitro-N-[[5-phenacylsulfanyl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]methyl]benzamide |
| SMILES | Cc1ccc(C(=O)NCc2nnc(SCC(=O)c3ccccc3)n2-c2cccc(C(F)(F)F)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H20F3N5O4S/c1-16-10-11-18(12-21(16)34(37)38)24(36)30-14-23-31-32-25(39-15-22(35)17-6-3-2-4-7-17)33(23)20-9-5-8-19(13-20)26(27,28)29/h2-13H,14-15H2,1H3,(H,30,36) |
| InChIKey | GLLUPKTWWBUMHV-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.54 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|