C25H29F3N4O2S — CID 44913998
4-butoxy-N-[[5-butylsulfanyl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]methyl]benzamide (PubChem CID 44913998) has the molecular formula C25H29F3N4O2S and a molecular weight of 506.59 g/mol. Its IUPAC name is 4-butoxy-N-[[5-butylsulfanyl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]methyl]benzamide.
| Compound Name | 4-butoxy-N-[[5-butylsulfanyl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 44913998 |
| Molecular Formula | C25H29F3N4O2S |
| Molecular Weight | 506.59 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | 4-butoxy-N-[[5-butylsulfanyl-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]methyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NCc2nnc(SCCCC)n2-c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C25H29F3N4O2S/c1-3-5-14-34-21-12-10-18(11-13-21)23(33)29-17-22-30-31-24(35-15-6-4-2)32(22)20-9-7-8-19(16-20)25(26,27)28/h7-13,16H,3-6,14-15,17H2,1-2H3,(H,29,33) |
| InChIKey | RBYDVPGMJVUIAE-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.59 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|