C29H29F3N4O3S — CID 44913982
4-butoxy-N-[[4-(2-methoxyphenyl)-5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-1,2,4-triazol-3-yl]methyl]benzamide (PubChem CID 44913982) has the molecular formula C29H29F3N4O3S and a molecular weight of 570.64 g/mol. Its IUPAC name is 4-butoxy-N-[[4-(2-methoxyphenyl)-5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-1,2,4-triazol-3-yl]methyl]benzamide.
| Compound Name | 4-butoxy-N-[[4-(2-methoxyphenyl)-5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-1,2,4-triazol-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 44913982 |
| Molecular Formula | C29H29F3N4O3S |
| Molecular Weight | 570.64 g/mol |
| Exact Mass | 570.19 |
| IUPAC Name | 4-butoxy-N-[[4-(2-methoxyphenyl)-5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-1,2,4-triazol-3-yl]methyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NCc2nnc(SCc3cccc(C(F)(F)F)c3)n2-c2ccccc2OC)cc1 |
| InChI | InChI=1S/C29H29F3N4O3S/c1-3-4-16-39-23-14-12-21(13-15-23)27(37)33-18-26-34-35-28(36(26)24-10-5-6-11-25(24)38-2)40-19-20-8-7-9-22(17-20)29(30,31)32/h5-15,17H,3-4,16,18-19H2,1-2H3,(H,33,37) |
| InChIKey | ILSIETYSCCPSRA-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.64 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|