C29H31ClN4O2S — CID 42746627
4-butoxy-N-[[4-(5-chloro-2-methylphenyl)-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]benzamide (PubChem CID 42746627) has the molecular formula C29H31ClN4O2S and a molecular weight of 535.11 g/mol. Its IUPAC name is 4-butoxy-N-[[4-(5-chloro-2-methylphenyl)-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]benzamide.
| Compound Name | 4-butoxy-N-[[4-(5-chloro-2-methylphenyl)-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 42746627 |
| Molecular Formula | C29H31ClN4O2S |
| Molecular Weight | 535.11 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | 4-butoxy-N-[[4-(5-chloro-2-methylphenyl)-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NCc2nnc(SCc3cccc(C)c3)n2-c2cc(Cl)ccc2C)cc1 |
| InChI | InChI=1S/C29H31ClN4O2S/c1-4-5-15-36-25-13-10-23(11-14-25)28(35)31-18-27-32-33-29(37-19-22-8-6-7-20(2)16-22)34(27)26-17-24(30)12-9-21(26)3/h6-14,16-17H,4-5,15,18-19H2,1-3H3,(H,31,35) |
| InChIKey | GFZNZAUIZPUXQX-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.11 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|