C24H28Cl2N4OS — CID 4689140
N-[[4-(2,5-dichlorophenyl)-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]heptanamide (PubChem CID 4689140) has the molecular formula C24H28Cl2N4OS and a molecular weight of 491.49 g/mol. Its IUPAC name is N-[[4-(2,5-dichlorophenyl)-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]heptanamide.
| Compound Name | N-[[4-(2,5-dichlorophenyl)-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]heptanamide |
|---|---|
| PubChem CID | 4689140 |
| Molecular Formula | C24H28Cl2N4OS |
| Molecular Weight | 491.49 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | N-[[4-(2,5-dichlorophenyl)-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]heptanamide |
| SMILES | CCCCCCC(=O)NCc1nnc(SCc2cccc(C)c2)n1-c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C24H28Cl2N4OS/c1-3-4-5-6-10-23(31)27-15-22-28-29-24(32-16-18-9-7-8-17(2)13-18)30(22)21-14-19(25)11-12-20(21)26/h7-9,11-14H,3-6,10,15-16H2,1-2H3,(H,27,31) |
| InChIKey | DZNABKJPJTUISC-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.49 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|