C25H22ClN5O3S — CID 42746589
N-[[4-(5-chloro-2-methylphenyl)-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-3-nitrobenzamide (PubChem CID 42746589) has the molecular formula C25H22ClN5O3S and a molecular weight of 508.00 g/mol. Its IUPAC name is N-[[4-(5-chloro-2-methylphenyl)-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-3-nitrobenzamide.
| Compound Name | N-[[4-(5-chloro-2-methylphenyl)-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 42746589 |
| Molecular Formula | C25H22ClN5O3S |
| Molecular Weight | 508.00 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | N-[[4-(5-chloro-2-methylphenyl)-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-3-nitrobenzamide |
| SMILES | Cc1cccc(CSc2nnc(CNC(=O)c3cccc([N+](=O)[O-])c3)n2-c2cc(Cl)ccc2C)c1 |
| InChI | InChI=1S/C25H22ClN5O3S/c1-16-5-3-6-18(11-16)15-35-25-29-28-23(30(25)22-13-20(26)10-9-17(22)2)14-27-24(32)19-7-4-8-21(12-19)31(33)34/h3-13H,14-15H2,1-2H3,(H,27,32) |
| InChIKey | FZEGZGYHRVZTSI-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.00 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|