C24H19Cl2N5O3S — CID 42746455
N-[[4-(2,4-dichlorophenyl)-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-3-nitrobenzamide (PubChem CID 42746455) has the molecular formula C24H19Cl2N5O3S and a molecular weight of 528.42 g/mol. Its IUPAC name is N-[[4-(2,4-dichlorophenyl)-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-3-nitrobenzamide.
| Compound Name | N-[[4-(2,4-dichlorophenyl)-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 42746455 |
| Molecular Formula | C24H19Cl2N5O3S |
| Molecular Weight | 528.42 g/mol |
| Exact Mass | 527.06 |
| IUPAC Name | N-[[4-(2,4-dichlorophenyl)-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-3-nitrobenzamide |
| SMILES | Cc1cccc(CSc2nnc(CNC(=O)c3cccc([N+](=O)[O-])c3)n2-c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C24H19Cl2N5O3S/c1-15-4-2-5-16(10-15)14-35-24-29-28-22(30(24)21-9-8-18(25)12-20(21)26)13-27-23(32)17-6-3-7-19(11-17)31(33)34/h2-12H,13-14H2,1H3,(H,27,32) |
| InChIKey | NJJWGRRHUGAWEH-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.42 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|