C26H25N5O4S — CID 40827330
N-[[4-(2,5-dimethylphenyl)-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-4-methoxybenzamide (PubChem CID 40827330) has the molecular formula C26H25N5O4S and a molecular weight of 503.58 g/mol. Its IUPAC name is N-[[4-(2,5-dimethylphenyl)-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-4-methoxybenzamide.
| Compound Name | N-[[4-(2,5-dimethylphenyl)-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 40827330 |
| Molecular Formula | C26H25N5O4S |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | N-[[4-(2,5-dimethylphenyl)-5-[(4-nitrophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCc2nnc(SCc3ccc([N+](=O)[O-])cc3)n2-c2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C26H25N5O4S/c1-17-4-5-18(2)23(14-17)30-24(15-27-25(32)20-8-12-22(35-3)13-9-20)28-29-26(30)36-16-19-6-10-21(11-7-19)31(33)34/h4-14H,15-16H2,1-3H3,(H,27,32) |
| InChIKey | WESCBMRTIPAGSJ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|