C23H16Cl2FN5O3S — CID 42659219
N-[[4-(2,5-dichlorophenyl)-5-[(4-fluorophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-4-nitrobenzamide (PubChem CID 42659219) has the molecular formula C23H16Cl2FN5O3S and a molecular weight of 532.38 g/mol. Its IUPAC name is N-[[4-(2,5-dichlorophenyl)-5-[(4-fluorophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-4-nitrobenzamide.
| Compound Name | N-[[4-(2,5-dichlorophenyl)-5-[(4-fluorophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 42659219 |
| Molecular Formula | C23H16Cl2FN5O3S |
| Molecular Weight | 532.38 g/mol |
| Exact Mass | 531.03 |
| IUPAC Name | N-[[4-(2,5-dichlorophenyl)-5-[(4-fluorophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-4-nitrobenzamide |
| SMILES | O=C(NCc1nnc(SCc2ccc(F)cc2)n1-c1cc(Cl)ccc1Cl)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H16Cl2FN5O3S/c24-16-5-10-19(25)20(11-16)30-21(12-27-22(32)15-3-8-18(9-4-15)31(33)34)28-29-23(30)35-13-14-1-6-17(26)7-2-14/h1-11H,12-13H2,(H,27,32) |
| InChIKey | NDQIZDPLUPOPQW-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.38 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|