C28H27Cl2FN4OS — CID 3413016
N-[[4-(2,5-dichlorophenyl)-5-[(4-fluorophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-4-pentylbenzamide (PubChem CID 3413016) has the molecular formula C28H27Cl2FN4OS and a molecular weight of 557.52 g/mol. Its IUPAC name is N-[[4-(2,5-dichlorophenyl)-5-[(4-fluorophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-4-pentylbenzamide.
| Compound Name | N-[[4-(2,5-dichlorophenyl)-5-[(4-fluorophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-4-pentylbenzamide |
|---|---|
| PubChem CID | 3413016 |
| Molecular Formula | C28H27Cl2FN4OS |
| Molecular Weight | 557.52 g/mol |
| Exact Mass | 556.13 |
| IUPAC Name | N-[[4-(2,5-dichlorophenyl)-5-[(4-fluorophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-4-pentylbenzamide |
| SMILES | CCCCCc1ccc(C(=O)NCc2nnc(SCc3ccc(F)cc3)n2-c2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C28H27Cl2FN4OS/c1-2-3-4-5-19-6-10-21(11-7-19)27(36)32-17-26-33-34-28(37-18-20-8-13-23(31)14-9-20)35(26)25-16-22(29)12-15-24(25)30/h6-16H,2-5,17-18H2,1H3,(H,32,36) |
| InChIKey | UZXNOLCXWLPHNB-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.52 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|