C29H30Cl2N4OS — CID 4590592
N-[[4-(2,5-dichlorophenyl)-5-[(2-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-4-pentylbenzamide (PubChem CID 4590592) has the molecular formula C29H30Cl2N4OS and a molecular weight of 553.56 g/mol. Its IUPAC name is N-[[4-(2,5-dichlorophenyl)-5-[(2-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-4-pentylbenzamide.
| Compound Name | N-[[4-(2,5-dichlorophenyl)-5-[(2-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-4-pentylbenzamide |
|---|---|
| PubChem CID | 4590592 |
| Molecular Formula | C29H30Cl2N4OS |
| Molecular Weight | 553.56 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | N-[[4-(2,5-dichlorophenyl)-5-[(2-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-4-pentylbenzamide |
| SMILES | CCCCCc1ccc(C(=O)NCc2nnc(SCc3ccccc3C)n2-c2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C29H30Cl2N4OS/c1-3-4-5-9-21-11-13-22(14-12-21)28(36)32-18-27-33-34-29(37-19-23-10-7-6-8-20(23)2)35(27)26-17-24(30)15-16-25(26)31/h6-8,10-17H,3-5,9,18-19H2,1-2H3,(H,32,36) |
| InChIKey | CRPSPWSEUWVJDX-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.56 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|