C24H18Cl2FN5O3S — CID 42746010
N-[1-[4-(2,4-dichlorophenyl)-5-[(4-fluorophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]ethyl]-4-nitrobenzamide (PubChem CID 42746010) has the molecular formula C24H18Cl2FN5O3S and a molecular weight of 546.41 g/mol. Its IUPAC name is N-[1-[4-(2,4-dichlorophenyl)-5-[(4-fluorophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]ethyl]-4-nitrobenzamide.
| Compound Name | N-[1-[4-(2,4-dichlorophenyl)-5-[(4-fluorophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]ethyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 42746010 |
| Molecular Formula | C24H18Cl2FN5O3S |
| Molecular Weight | 546.41 g/mol |
| Exact Mass | 545.05 |
| IUPAC Name | N-[1-[4-(2,4-dichlorophenyl)-5-[(4-fluorophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]ethyl]-4-nitrobenzamide |
| SMILES | CC(NC(=O)c1ccc([N+](=O)[O-])cc1)c1nnc(SCc2ccc(F)cc2)n1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H18Cl2FN5O3S/c1-14(28-23(33)16-4-9-19(10-5-16)32(34)35)22-29-30-24(36-13-15-2-7-18(27)8-3-15)31(22)21-11-6-17(25)12-20(21)26/h2-12,14H,13H2,1H3,(H,28,33) |
| InChIKey | POUNLBZQBCBSFI-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.41 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|